C18H33O3P — CID 11255925
(4E)-5-butyl-4-diethoxyphosphoryldeca-1,4,9-triene (PubChem CID 11255925) has the molecular formula C18H33O3P and a molecular weight of 328.43 g/mol. Its IUPAC name is (4E)-5-butyl-4-diethoxyphosphoryldeca-1,4,9-triene.
| Compound Name | (4E)-5-butyl-4-diethoxyphosphoryldeca-1,4,9-triene |
|---|---|
| PubChem CID | 11255925 |
| Molecular Formula | C18H33O3P |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (4E)-5-butyl-4-diethoxyphosphoryldeca-1,4,9-triene |
| SMILES | C=CCCC/C(CCCC)=C(\CC=C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H33O3P/c1-6-11-13-16-17(15-12-7-2)18(14-8-3)22(19,20-9-4)21-10-5/h6,8H,1,3,7,9-16H2,2,4-5H3/b18-17+ |
| InChIKey | DMSLSSYNBLJEGT-ISLYRVAYSA-N |
| XLogP | 6.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|