About 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine
4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine (PubChem CID 112559774) has the molecular formula C14H18N4
and a molecular weight of 242.33 g/mol. Its IUPAC name is 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine |
| PubChem CID | 112559774 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine |
| SMILES | CCNc1cc(NCC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4/c1-3-15-12-10-13(16-4-2)18-14(17-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | MPHXPKHHBOYAGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine?
The IUPAC name of 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine (CID 112559774) is 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine.
What is the SMILES notation for 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine?
The canonical SMILES for 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine is CCNc1cc(NCC)nc(-c2ccccc2)n1.
What is the InChIKey of 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine?
The InChIKey is MPHXPKHHBOYAGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4/c1-3-15-12-10-13(16-4-2)18-14(17-12)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3,(H2,15,16,17,18).
What are the key properties of 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine?
4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine has a molecular weight of 242.33 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,6-N-diethyl-2-phenylpyrimidine-4,6-diamine is sourced from PubChem (CID 112559774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).