About 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one
5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one (PubChem CID 11255980) has the molecular formula C21H18N2O2
and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one.
Molecular Properties
| Compound Name | 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one |
| PubChem CID | 11255980 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one |
| SMILES | CCCn1cc(-c2c(-c3ccccc3)oc3cccnc23)ccc1=O |
| InChI | InChI=1S/C21H18N2O2/c1-2-13-23-14-16(10-11-18(23)24)19-20-17(9-6-12-22-20)25-21(19)15-7-4-3-5-8-15/h3-12,14H,2,13H2,1H3 |
| InChIKey | MVEGWZPJBCRZSR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one?
The IUPAC name of 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one (CID 11255980) is 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one.
What is the SMILES notation for 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one?
The canonical SMILES for 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one is CCCn1cc(-c2c(-c3ccccc3)oc3cccnc23)ccc1=O.
What is the InChIKey of 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one?
The InChIKey is MVEGWZPJBCRZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O2/c1-2-13-23-14-16(10-11-18(23)24)19-20-17(9-6-12-22-20)25-21(19)15-7-4-3-5-8-15/h3-12,14H,2,13H2,1H3.
What are the key properties of 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one?
5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one has a molecular weight of 330.39 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-phenylfuro[3,2-b]pyridin-3-yl)-1-propylpyridin-2-one is sourced from PubChem (CID 11255980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).