C24H29N — CID 11256011
1-[(3R,5R)-3,5-diphenyl-1-bicyclo[2.2.2]octanyl]pyrrolidine (PubChem CID 11256011) has the molecular formula C24H29N and a molecular weight of 331.50 g/mol. Its IUPAC name is 1-[(3R,5R)-3,5-diphenyl-1-bicyclo[2.2.2]octanyl]pyrrolidine.
| Compound Name | 1-[(3R,5R)-3,5-diphenyl-1-bicyclo[2.2.2]octanyl]pyrrolidine |
|---|---|
| PubChem CID | 11256011 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(3R,5R)-3,5-diphenyl-1-bicyclo[2.2.2]octanyl]pyrrolidine |
| SMILES | c1ccc([C@@H]2CC3(N4CCCC4)CCC2[C@H](c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C24H29N/c1-3-9-19(10-4-1)22-17-24(25-15-7-8-16-25)14-13-21(22)23(18-24)20-11-5-2-6-12-20/h1-6,9-12,21-23H,7-8,13-18H2/t21?,22-,23-,24?/m0/s1 |
| InChIKey | GQBUTRRAYWNZDO-XZZNXKJUSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |