C9H9ClF3NO2 — CID 112560294
1-(3-chloro-2-hydroxypropyl)-5-(trifluoromethyl)pyridin-2-one (PubChem CID 112560294) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is 1-(3-chloro-2-hydroxypropyl)-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-(3-chloro-2-hydroxypropyl)-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 112560294 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 1-(3-chloro-2-hydroxypropyl)-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1ccc(C(F)(F)F)cn1CC(O)CCl |
| InChI | InChI=1S/C9H9ClF3NO2/c10-3-7(15)5-14-4-6(9(11,12)13)1-2-8(14)16/h1-2,4,7,15H,3,5H2 |
| InChIKey | JGNOTVCOHRJXNU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|