C22H36O2 — CID 11256046
(2S,4R,6S)-3,3-dimethyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexan-1-one (PubChem CID 11256046) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2S,4R,6S)-3,3-dimethyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexan-1-one.
| Compound Name | (2S,4R,6S)-3,3-dimethyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11256046 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2S,4R,6S)-3,3-dimethyl-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexan-1-one |
| SMILES | CC(C)=CC[C@H]1C[C@@H](CC=C(C)C)C(C)(C)[C@@H](C(=O)C(C)C)C1=O |
| InChI | InChI=1S/C22H36O2/c1-14(2)9-11-17-13-18(12-10-15(3)4)22(7,8)19(21(17)24)20(23)16(5)6/h9-10,16-19H,11-13H2,1-8H3/t17-,18+,19-/m0/s1 |
| InChIKey | RSIDASPVNMMKMN-OTWHNJEPSA-N |
| XLogP | 5.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|