C19H27NO2S — CID 11256085
(1R)-1-[6-[(1S,4R,6R,8R)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecan-4-yl]-2-pyridinyl]propan-1-ol (PubChem CID 11256085) has the molecular formula C19H27NO2S and a molecular weight of 333.50 g/mol. Its IUPAC name is (1R)-1-[6-[(1S,4R,6R,8R)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecan-4-yl]-2-pyridinyl]propan-1-ol.
| Compound Name | (1R)-1-[6-[(1S,4R,6R,8R)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecan-4-yl]-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 11256085 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (1R)-1-[6-[(1S,4R,6R,8R)-11,11-dimethyl-5-oxa-3-thiatricyclo[6.2.1.01,6]undecan-4-yl]-2-pyridinyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1cccc([C@@H]2O[C@@H]3C[C@H]4CC[C@]3(CS2)C4(C)C)n1 |
| InChI | InChI=1S/C19H27NO2S/c1-4-15(21)13-6-5-7-14(20-13)17-22-16-10-12-8-9-19(16,11-23-17)18(12,2)3/h5-7,12,15-17,21H,4,8-11H2,1-3H3/t12-,15-,16-,17-,19-/m1/s1 |
| InChIKey | NTXLTCASAOWWJK-QLXPXKAKSA-N |
| XLogP | 4.48 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |