C21H34O3 — CID 11256124
(2S,4R,6S,8S)-9-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethylnonanal (PubChem CID 11256124) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2S,4R,6S,8S)-9-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethylnonanal.
| Compound Name | (2S,4R,6S,8S)-9-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethylnonanal |
|---|---|
| PubChem CID | 11256124 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2S,4R,6S,8S)-9-[(4-methoxyphenyl)methoxy]-2,4,6,8-tetramethylnonanal |
| SMILES | COc1ccc(COC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)C=O)cc1 |
| InChI | InChI=1S/C21H34O3/c1-16(11-18(3)13-22)10-17(2)12-19(4)14-24-15-20-6-8-21(23-5)9-7-20/h6-9,13,16-19H,10-12,14-15H2,1-5H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | ZZMCMYBKCMGRDK-XWSJACJDSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|