C15H15FN2O6 — CID 11256203
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-fluorophenyl)pyrimidine-2,4-dione (PubChem CID 11256203) has the molecular formula C15H15FN2O6 and a molecular weight of 337.29 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-fluorophenyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-fluorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11256203 |
| Molecular Formula | C15H15FN2O6 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(4-fluorophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)cc1-c1ccc([18F])cc1 |
| InChI | InChI=1S/C15H15FN2O6/c16-8-3-1-7(2-4-8)9-5-18(15(23)17-13(9)22)14-12(21)11(20)10(6-19)24-14/h1-5,10-12,14,19-21H,6H2,(H,17,22,23)/t10-,11-,12-,14-/m1/s1/i16-1 |
| InChIKey | ODTOTAWOCYRXRY-CWRRIEPKSA-N |
| XLogP | -1.05 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |