C13H25FN2O2S — CID 112562286
4-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-amine (PubChem CID 112562286) has the molecular formula C13H25FN2O2S and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-amine.
| Compound Name | 4-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 112562286 |
| Molecular Formula | C13H25FN2O2S |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4-fluoro-4-[(1-methylsulfonylpiperidin-3-yl)methyl]cyclohexan-1-amine |
| SMILES | CS(=O)(=O)N1CCCC(CC2(F)CCC(N)CC2)C1 |
| InChI | InChI=1S/C13H25FN2O2S/c1-19(17,18)16-8-2-3-11(10-16)9-13(14)6-4-12(15)5-7-13/h11-12H,2-10,15H2,1H3 |
| InChIKey | XPURFPWNPZAFME-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |