C10H18FNO2 — CID 112562656
2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoroethanamine (PubChem CID 112562656) has the molecular formula C10H18FNO2 and a molecular weight of 203.26 g/mol. Its IUPAC name is 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoroethanamine.
| Compound Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoroethanamine |
|---|---|
| PubChem CID | 112562656 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(2,6-dioxaspiro[4.5]decan-9-yl)-2-fluoroethanamine |
| SMILES | NCC(F)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C10H18FNO2/c11-9(6-12)8-1-3-14-10(5-8)2-4-13-7-10/h8-9H,1-7,12H2 |
| InChIKey | ZFASBCFDKRLZSG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |