About 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine
3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine (PubChem CID 112563005) has the molecular formula C11H19FN4
and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine |
| PubChem CID | 112563005 |
| Molecular Formula | C11H19FN4 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine |
| SMILES | CCCn1ncnc1CC1(F)CCCNC1 |
| InChI | InChI=1S/C11H19FN4/c1-2-6-16-10(14-9-15-16)7-11(12)4-3-5-13-8-11/h9,13H,2-8H2,1H3 |
| InChIKey | OLZLJDDNAJUXPW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine?
The IUPAC name of 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine (CID 112563005) is 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine.
What is the SMILES notation for 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine?
The canonical SMILES for 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine is CCCn1ncnc1CC1(F)CCCNC1.
What is the InChIKey of 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine?
The InChIKey is OLZLJDDNAJUXPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FN4/c1-2-6-16-10(14-9-15-16)7-11(12)4-3-5-13-8-11/h9,13H,2-8H2,1H3.
What are the key properties of 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine?
3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine has a molecular weight of 226.30 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-[(2-propyl-1,2,4-triazol-3-yl)methyl]piperidine is sourced from PubChem (CID 112563005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).