About (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane
(4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (PubChem CID 11256397) has the molecular formula C16H24Cl2N2Si
and a molecular weight of 343.37 g/mol. Its IUPAC name is (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| PubChem CID | 11256397 |
| Molecular Formula | C16H24Cl2N2Si |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(Cl)c(Cl)cnc21 |
| InChI | InChI=1S/C16H24Cl2N2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-15(18)14(17)9-19-16(13)20/h7-12H,1-6H3 |
| InChIKey | JUZAIMKYOWCVOY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane?
The IUPAC name of (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CID 11256397) is (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane.
What is the SMILES notation for (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane?
The canonical SMILES for (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(Cl)c(Cl)cnc21.
What is the InChIKey of (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane?
The InChIKey is JUZAIMKYOWCVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24Cl2N2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-15(18)14(17)9-19-16(13)20/h7-12H,1-6H3.
What are the key properties of (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane?
(4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane has a molecular weight of 343.37 g/mol, XLogP of 6.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dichloropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane is sourced from PubChem (CID 11256397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).