About benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate
benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate (PubChem CID 11256402) has the molecular formula C19H18FNO2S
and a molecular weight of 343.42 g/mol. Its IUPAC name is benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate |
| PubChem CID | 11256402 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate |
| SMILES | O=C(Nc1ccc(C2=CCSCC2)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C19H18FNO2S/c20-18-12-16(6-7-17(18)15-8-10-24-11-9-15)21-19(22)23-13-14-4-2-1-3-5-14/h1-8,12H,9-11,13H2,(H,21,22) |
| InChIKey | LELAEPYPNYDUEU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The IUPAC name of benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate (CID 11256402) is benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate.
What is the SMILES notation for benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The canonical SMILES for benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate is O=C(Nc1ccc(C2=CCSCC2)c(F)c1)OCc1ccccc1.
What is the InChIKey of benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
The InChIKey is LELAEPYPNYDUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FNO2S/c20-18-12-16(6-7-17(18)15-8-10-24-11-9-15)21-19(22)23-13-14-4-2-1-3-5-14/h1-8,12H,9-11,13H2,(H,21,22).
What are the key properties of benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate?
benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate has a molecular weight of 343.42 g/mol, XLogP of 5.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(3,6-dihydro-2H-thiopyran-4-yl)-3-fluorophenyl]carbamate is sourced from PubChem (CID 11256402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).