About 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile
4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile (PubChem CID 11256439) has the molecular formula C20H20N6
and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile |
| PubChem CID | 11256439 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(NCc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H20N6/c1-2-17-18(19(22)26-20(23)25-17)15-7-9-16(10-8-15)24-12-14-5-3-13(11-21)4-6-14/h3-10,24H,2,12H2,1H3,(H4,22,23,25,26) |
| InChIKey | FXWGMDQMRCPBHI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile?
The IUPAC name of 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile (CID 11256439) is 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile.
What is the SMILES notation for 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile?
The canonical SMILES for 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile is CCc1nc(N)nc(N)c1-c1ccc(NCc2ccc(C#N)cc2)cc1.
What is the InChIKey of 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile?
The InChIKey is FXWGMDQMRCPBHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N6/c1-2-17-18(19(22)26-20(23)25-17)15-7-9-16(10-8-15)24-12-14-5-3-13(11-21)4-6-14/h3-10,24H,2,12H2,1H3,(H4,22,23,25,26).
What are the key properties of 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile?
4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile has a molecular weight of 344.42 g/mol, XLogP of 3.35, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,4-diamino-6-ethylpyrimidin-5-yl)anilino]methyl]benzonitrile is sourced from PubChem (CID 11256439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).