C20H31NO2S — CID 11256589
(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-4-(phenylsulfonimidoyl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 11256589) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-4-(phenylsulfonimidoyl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-4-(phenylsulfonimidoyl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 11256589 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-4-(phenylsulfonimidoyl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | [H]N=S(=O)(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C)c1ccccc1 |
| InChI | InChI=1S/C20H31NO2S/c1-15(12-14-24(21,23)16-7-4-3-5-8-16)17-10-11-18-19(22)9-6-13-20(17,18)2/h3-5,7-8,15,17-19,21-22H,6,9-14H2,1-2H3/t15-,17-,18+,19+,20-,24?/m1/s1 |
| InChIKey | KKKYGQMNWCKOQP-JXQOHXAGSA-N |
| XLogP | 4.70 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |