About 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine (PubChem CID 112566116) has the molecular formula C12H21ClFN3
and a molecular weight of 261.77 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine.
Molecular Properties
| Compound Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine |
| PubChem CID | 112566116 |
| Molecular Formula | C12H21ClFN3 |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine |
| SMILES | CCc1nn(CC)c(CC(F)(CC)CN)c1Cl |
| InChI | InChI=1S/C12H21ClFN3/c1-4-9-11(13)10(17(6-3)16-9)7-12(14,5-2)8-15/h4-8,15H2,1-3H3 |
| InChIKey | GCMQDVRDSAPMEH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine?
The IUPAC name of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine (CID 112566116) is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine.
What is the SMILES notation for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine?
The canonical SMILES for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine is CCc1nn(CC)c(CC(F)(CC)CN)c1Cl.
What is the InChIKey of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine?
The InChIKey is GCMQDVRDSAPMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClFN3/c1-4-9-11(13)10(17(6-3)16-9)7-12(14,5-2)8-15/h4-8,15H2,1-3H3.
What are the key properties of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine?
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine has a molecular weight of 261.77 g/mol, XLogP of 2.74, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2-fluorobutan-1-amine is sourced from PubChem (CID 112566116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).