About 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine
2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (PubChem CID 112566441) has the molecular formula C10H17FN2S
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
Molecular Properties
| Compound Name | 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| PubChem CID | 112566441 |
| Molecular Formula | C10H17FN2S |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine |
| SMILES | CC(C)(C)C(F)(CN)Cc1nccs1 |
| InChI | InChI=1S/C10H17FN2S/c1-9(2,3)10(11,7-12)6-8-13-4-5-14-8/h4-5H,6-7,12H2,1-3H3 |
| InChIKey | AUPOCKZISNBDRM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The IUPAC name of 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine (CID 112566441) is 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine.
What is the SMILES notation for 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The canonical SMILES for 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is CC(C)(C)C(F)(CN)Cc1nccs1.
What is the InChIKey of 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
The InChIKey is AUPOCKZISNBDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17FN2S/c1-9(2,3)10(11,7-12)6-8-13-4-5-14-8/h4-5H,6-7,12H2,1-3H3.
What are the key properties of 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine?
2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine has a molecular weight of 216.32 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,3-dimethyl-2-(1,3-thiazol-2-ylmethyl)butan-1-amine is sourced from PubChem (CID 112566441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).