C20H32O5 — CID 11256685
ditert-butyl (1S,2S,3E)-9-oxocyclodec-3-ene-1,2-dicarboxylate (PubChem CID 11256685) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3E)-9-oxocyclodec-3-ene-1,2-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3E)-9-oxocyclodec-3-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11256685 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ditert-butyl (1S,2S,3E)-9-oxocyclodec-3-ene-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1/C=C/CCCCC(=O)C[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32O5/c1-19(2,3)24-17(22)15-12-10-8-7-9-11-14(21)13-16(15)18(23)25-20(4,5)6/h10,12,15-16H,7-9,11,13H2,1-6H3/b12-10+/t15-,16-/m0/s1 |
| InChIKey | MFQQWILHIJVDFL-VMNGNHSPSA-N |
| XLogP | 3.99 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|