C17H28O6Si — CID 11256818
(3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-[(E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoyl]oxolan-2-one (PubChem CID 11256818) has the molecular formula C17H28O6Si and a molecular weight of 356.49 g/mol. Its IUPAC name is (3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-[(E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoyl]oxolan-2-one.
| Compound Name | (3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-[(E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoyl]oxolan-2-one |
|---|---|
| PubChem CID | 11256818 |
| Molecular Formula | C17H28O6Si |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (3S,4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3-[(E)-3-[(2S,3R)-3-methyloxiran-2-yl]prop-2-enoyl]oxolan-2-one |
| SMILES | C[C@H]1O[C@H]1/C=C/C(=O)[C@]1(O)C(=O)OC[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O6Si/c1-11-13(23-11)7-8-14(18)17(20)12(9-21-15(17)19)10-22-24(5,6)16(2,3)4/h7-8,11-13,20H,9-10H2,1-6H3/b8-7+/t11-,12-,13+,17+/m1/s1 |
| InChIKey | DEDFVGFJCKODGY-QGIIFMTQSA-N |
| XLogP | 1.82 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|