About methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate
methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate (PubChem CID 112569150) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate.
Molecular Properties
| Compound Name | methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate |
| PubChem CID | 112569150 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate |
| SMILES | CCC(C)c1noc(C(C(=O)OC)C2CCCC2)n1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-9(2)12-15-13(19-16-12)11(14(17)18-3)10-7-5-6-8-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | YPDCOTXDTNNFLD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate?
The IUPAC name of methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate (CID 112569150) is methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate.
What is the SMILES notation for methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate?
The canonical SMILES for methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate is CCC(C)c1noc(C(C(=O)OC)C2CCCC2)n1.
What is the InChIKey of methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate?
The InChIKey is YPDCOTXDTNNFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-4-9(2)12-15-13(19-16-12)11(14(17)18-3)10-7-5-6-8-10/h9-11H,4-8H2,1-3H3.
What are the key properties of methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate?
methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate has a molecular weight of 266.34 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-butan-2-yl-1,2,4-oxadiazol-5-yl)-2-cyclopentylacetate is sourced from PubChem (CID 112569150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).