C13H18N2O2S — CID 112569368
5-cyclopentyl-4-hydroxy-2-(thiolan-2-yl)-1H-pyrimidin-6-one (PubChem CID 112569368) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 5-cyclopentyl-4-hydroxy-2-(thiolan-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-cyclopentyl-4-hydroxy-2-(thiolan-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 112569368 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-cyclopentyl-4-hydroxy-2-(thiolan-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CCCS2)nc(O)c1C1CCCC1 |
| InChI | InChI=1S/C13H18N2O2S/c16-12-10(8-4-1-2-5-8)13(17)15-11(14-12)9-6-3-7-18-9/h8-9H,1-7H2,(H2,14,15,16,17) |
| InChIKey | POWFYDQFJSSXGK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |