About 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine
2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine (PubChem CID 112569483) has the molecular formula C13H19Cl2N3
and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine |
| PubChem CID | 112569483 |
| Molecular Formula | C13H19Cl2N3 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1nc(Cl)c(C2CCCC2)c(Cl)n1 |
| InChI | InChI=1S/C13H19Cl2N3/c1-18(2)8-7-10-16-12(14)11(13(15)17-10)9-5-3-4-6-9/h9H,3-8H2,1-2H3 |
| InChIKey | ZJDOEQHQXMPTIU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine (CID 112569483) is 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine is CN(C)CCc1nc(Cl)c(C2CCCC2)c(Cl)n1.
What is the InChIKey of 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine?
The InChIKey is ZJDOEQHQXMPTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2N3/c1-18(2)8-7-10-16-12(14)11(13(15)17-10)9-5-3-4-6-9/h9H,3-8H2,1-2H3.
What are the key properties of 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine?
2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine has a molecular weight of 288.22 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dichloro-5-cyclopentylpyrimidin-2-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 112569483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).