C21H35NO2Si — CID 11256980
[(1S,2R,8aS)-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11256980) has the molecular formula C21H35NO2Si and a molecular weight of 361.60 g/mol. Its IUPAC name is [(1S,2R,8aS)-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2R,8aS)-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11256980 |
| Molecular Formula | C21H35NO2Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | [(1S,2R,8aS)-1-phenylmethoxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CN2CCCC[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H35NO2Si/c1-21(2,3)25(4,5)24-19-15-22-14-10-9-13-18(22)20(19)23-16-17-11-7-6-8-12-17/h6-8,11-12,18-20H,9-10,13-16H2,1-5H3/t18-,19+,20-/m0/s1 |
| InChIKey | OTZFDVRLBAAUSK-ZCNNSNEGSA-N |
| XLogP | 4.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|