C13H23N3O — CID 112570348
2-cyclopentyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-1-ol (PubChem CID 112570348) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-cyclopentyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-1-ol.
| Compound Name | 2-cyclopentyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 112570348 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-cyclopentyl-3-(2-propyl-1,2,4-triazol-3-yl)propan-1-ol |
| SMILES | CCCn1ncnc1CC(CO)C1CCCC1 |
| InChI | InChI=1S/C13H23N3O/c1-2-7-16-13(14-10-15-16)8-12(9-17)11-5-3-4-6-11/h10-12,17H,2-9H2,1H3 |
| InChIKey | SNSSFIHGNNUCMO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |