C13H20ClNS — CID 112570415
5-(4-chloro-3-cyclopentylbutyl)-4-methyl-1,3-thiazole (PubChem CID 112570415) has the molecular formula C13H20ClNS and a molecular weight of 257.83 g/mol. Its IUPAC name is 5-(4-chloro-3-cyclopentylbutyl)-4-methyl-1,3-thiazole.
| Compound Name | 5-(4-chloro-3-cyclopentylbutyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 112570415 |
| Molecular Formula | C13H20ClNS |
| Molecular Weight | 257.83 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-(4-chloro-3-cyclopentylbutyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCC(CCl)C1CCCC1 |
| InChI | InChI=1S/C13H20ClNS/c1-10-13(16-9-15-10)7-6-12(8-14)11-4-2-3-5-11/h9,11-12H,2-8H2,1H3 |
| InChIKey | SVROIRFCWQIIGU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|