C17H18N8O2 — CID 11257094
2-(furan-2-yl)-5-[4-(furan-2-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine (PubChem CID 11257094) has the molecular formula C17H18N8O2 and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-[4-(furan-2-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine.
| Compound Name | 2-(furan-2-yl)-5-[4-(furan-2-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
|---|---|
| PubChem CID | 11257094 |
| Molecular Formula | C17H18N8O2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(furan-2-yl)-5-[4-(furan-2-ylmethyl)piperazin-1-yl]-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-amine |
| SMILES | Nc1nc(N2CCN(Cc3ccco3)CC2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C17H18N8O2/c18-15-20-16(21-17-19-14(22-25(15)17)13-4-2-10-27-13)24-7-5-23(6-8-24)11-12-3-1-9-26-12/h1-4,9-10H,5-8,11H2,(H2,18,19,20,21,22) |
| InChIKey | HLCUBWZJFIYLEE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |