About 3-bromo-5-methoxy-1,2,4-oxadiazole
3-bromo-5-methoxy-1,2,4-oxadiazole (PubChem CID 112571439) has the molecular formula C3H3BrN2O2
and a molecular weight of 178.97 g/mol. Its IUPAC name is 3-bromo-5-methoxy-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-bromo-5-methoxy-1,2,4-oxadiazole |
| PubChem CID | 112571439 |
| Molecular Formula | C3H3BrN2O2 |
| Molecular Weight | 178.97 g/mol |
| Exact Mass | 177.94 |
| IUPAC Name | 3-bromo-5-methoxy-1,2,4-oxadiazole |
| SMILES | COc1nc(Br)no1 |
| InChI | InChI=1S/C3H3BrN2O2/c1-7-3-5-2(4)6-8-3/h1H3 |
| InChIKey | RPJGGIOIJFJZJU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.97 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-5-methoxy-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-methoxy-1,2,4-oxadiazole?
The IUPAC name of 3-bromo-5-methoxy-1,2,4-oxadiazole (CID 112571439) is 3-bromo-5-methoxy-1,2,4-oxadiazole.
What is the SMILES notation for 3-bromo-5-methoxy-1,2,4-oxadiazole?
The canonical SMILES for 3-bromo-5-methoxy-1,2,4-oxadiazole is COc1nc(Br)no1.
What is the InChIKey of 3-bromo-5-methoxy-1,2,4-oxadiazole?
The InChIKey is RPJGGIOIJFJZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3BrN2O2/c1-7-3-5-2(4)6-8-3/h1H3.
What are the key properties of 3-bromo-5-methoxy-1,2,4-oxadiazole?
3-bromo-5-methoxy-1,2,4-oxadiazole has a molecular weight of 178.97 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-methoxy-1,2,4-oxadiazole is sourced from PubChem (CID 112571439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).