C16H27F2O5P — CID 11257150
[(1S,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohex-3-en-1-yl] 2,2-dimethylpropanoate (PubChem CID 11257150) has the molecular formula C16H27F2O5P and a molecular weight of 368.36 g/mol. Its IUPAC name is [(1S,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohex-3-en-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohex-3-en-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11257150 |
| Molecular Formula | C16H27F2O5P |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [(1S,2S)-2-[diethoxyphosphoryl(difluoro)methyl]cyclohex-3-en-1-yl] 2,2-dimethylpropanoate |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@H]1C=CCC[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H27F2O5P/c1-6-21-24(20,22-7-2)16(17,18)12-10-8-9-11-13(12)23-14(19)15(3,4)5/h8,10,12-13H,6-7,9,11H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | KJTXVCZQXTUFMW-STQMWFEESA-N |
| XLogP | 4.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|