C24H24N4 — CID 11257167
trans-(1R,2R)-1-N,2-N-di(quinolin-2-yl)cyclohexane-1,2-diamine (PubChem CID 11257167) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-di(quinolin-2-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-di(quinolin-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 11257167 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-di(quinolin-2-yl)cyclohexane-1,2-diamine |
| SMILES | c1ccc2nc(N[C@@H]3CCCC[C@H]3Nc3ccc4ccccc4n3)ccc2c1 |
| InChI | InChI=1S/C24H24N4/c1-3-9-19-17(7-1)13-15-23(25-19)27-21-11-5-6-12-22(21)28-24-16-14-18-8-2-4-10-20(18)26-24/h1-4,7-10,13-16,21-22H,5-6,11-12H2,(H,25,27)(H,26,28)/t21-,22-/m1/s1 |
| InChIKey | LBZHXHCNQBOGSV-FGZHOGPDSA-N |
| XLogP | 5.62 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |