About 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole
3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole (PubChem CID 112571697) has the molecular formula C6H4BrN3OS
and a molecular weight of 246.09 g/mol. Its IUPAC name is 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole.
Analyze 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole (CID 112571697) is 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole is Cc1ncsc1-c1nc(Br)no1.
What is the InChIKey of 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole?
The InChIKey is LVNIOEUJOLFZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3OS/c1-3-4(12-2-8-3)5-9-6(7)10-11-5/h2H,1H3.
What are the key properties of 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole?
3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole has a molecular weight of 246.09 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(4-methyl-1,3-thiazol-5-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 112571697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).