C25H40N2 — CID 11257172
1,4-bis[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepane (PubChem CID 11257172) has the molecular formula C25H40N2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 1,4-bis[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepane.
| Compound Name | 1,4-bis[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 11257172 |
| Molecular Formula | C25H40N2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | 1,4-bis[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]-1,4-diazepane |
| SMILES | C=C(C)[C@@H]1CC=C(CN2CCCN(CC3=CC[C@@H](C(=C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C25H40N2/c1-20(2)24-10-6-22(7-11-24)18-26-14-5-15-27(17-16-26)19-23-8-12-25(13-9-23)21(3)4/h6,8,24-25H,1,3,5,7,9-19H2,2,4H3/t24-,25-/m1/s1 |
| InChIKey | CKFCAUIGZCWBRY-JWQCQUIFSA-N |
| XLogP | 5.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|