About 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole
3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole (PubChem CID 112571868) has the molecular formula C10H7ClN2O2
and a molecular weight of 222.63 g/mol. Its IUPAC name is 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole |
| PubChem CID | 112571868 |
| Molecular Formula | C10H7ClN2O2 |
| Molecular Weight | 222.63 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole |
| SMILES | Clc1noc(-c2ccc3c(c2)COC3)n1 |
| InChI | InChI=1S/C10H7ClN2O2/c11-10-12-9(15-13-10)6-1-2-7-4-14-5-8(7)3-6/h1-3H,4-5H2 |
| InChIKey | CXGMAWPWIVBHIU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole (CID 112571868) is 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole is Clc1noc(-c2ccc3c(c2)COC3)n1.
What is the InChIKey of 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole?
The InChIKey is CXGMAWPWIVBHIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2O2/c11-10-12-9(15-13-10)6-1-2-7-4-14-5-8(7)3-6/h1-3H,4-5H2.
What are the key properties of 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole?
3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole has a molecular weight of 222.63 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-(1,3-dihydro-2-benzofuran-5-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 112571868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).