C8H3IN4O — CID 112572198
6-(3-iodo-1,2,4-oxadiazol-5-yl)pyridine-3-carbonitrile (PubChem CID 112572198) has the molecular formula C8H3IN4O and a molecular weight of 298.04 g/mol. Its IUPAC name is 6-(3-iodo-1,2,4-oxadiazol-5-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(3-iodo-1,2,4-oxadiazol-5-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 112572198 |
| Molecular Formula | C8H3IN4O |
| Molecular Weight | 298.04 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | 6-(3-iodo-1,2,4-oxadiazol-5-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2nc(I)no2)nc1 |
| InChI | InChI=1S/C8H3IN4O/c9-8-12-7(14-13-8)6-2-1-5(3-10)4-11-6/h1-2,4H |
| InChIKey | QULWHPHQIMKTSP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.04 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|