C10H16N2O4S — CID 112572750
6-(2-propoxyethoxy)pyridine-3-sulfonamide (PubChem CID 112572750) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is 6-(2-propoxyethoxy)pyridine-3-sulfonamide.
| Compound Name | 6-(2-propoxyethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 112572750 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 6-(2-propoxyethoxy)pyridine-3-sulfonamide |
| SMILES | CCCOCCOc1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C10H16N2O4S/c1-2-5-15-6-7-16-10-4-3-9(8-12-10)17(11,13)14/h3-4,8H,2,5-7H2,1H3,(H2,11,13,14) |
| InChIKey | SXTKTIGPWFUXSN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|