C11H6Cl3NO3S — CID 112573023
2-(3,4-dichlorophenoxy)pyridine-3-sulfonyl chloride (PubChem CID 112573023) has the molecular formula C11H6Cl3NO3S and a molecular weight of 338.60 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)pyridine-3-sulfonyl chloride.
| Compound Name | 2-(3,4-dichlorophenoxy)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 112573023 |
| Molecular Formula | C11H6Cl3NO3S |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cccnc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl3NO3S/c12-8-4-3-7(6-9(8)13)18-11-10(19(14,16)17)2-1-5-15-11/h1-6H |
| InChIKey | BXFNLZIEHYYPPM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |