C11H19N3O2S — CID 112573513
1-(diethylaminomethyl)-2-(sulfamoylamino)benzene (PubChem CID 112573513) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-(diethylaminomethyl)-2-(sulfamoylamino)benzene.
| Compound Name | 1-(diethylaminomethyl)-2-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 112573513 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(diethylaminomethyl)-2-(sulfamoylamino)benzene |
| SMILES | CCN(CC)Cc1ccccc1NS(N)(=O)=O |
| InChI | InChI=1S/C11H19N3O2S/c1-3-14(4-2)9-10-7-5-6-8-11(10)13-17(12,15)16/h5-8,13H,3-4,9H2,1-2H3,(H2,12,15,16) |
| InChIKey | PAAUBVBDMMRPTR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |