C7H12N4O4S — CID 112573865
2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-sulfonamide (PubChem CID 112573865) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-sulfonamide.
| Compound Name | 2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-sulfonamide |
|---|---|
| PubChem CID | 112573865 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2,4-dioxo-1,3,9-triazaspiro[4.5]decane-9-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C7H12N4O4S/c8-16(14,15)11-3-1-2-7(4-11)5(12)9-6(13)10-7/h1-4H2,(H2,8,14,15)(H2,9,10,12,13) |
| InChIKey | UTUGQXBFRZNIPF-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|