C9H15N3O2S — CID 112573869
2-(dimethylamino)-1-methyl-4-(sulfamoylamino)benzene (PubChem CID 112573869) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-(dimethylamino)-1-methyl-4-(sulfamoylamino)benzene.
| Compound Name | 2-(dimethylamino)-1-methyl-4-(sulfamoylamino)benzene |
|---|---|
| PubChem CID | 112573869 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(dimethylamino)-1-methyl-4-(sulfamoylamino)benzene |
| SMILES | Cc1ccc(NS(N)(=O)=O)cc1N(C)C |
| InChI | InChI=1S/C9H15N3O2S/c1-7-4-5-8(11-15(10,13)14)6-9(7)12(2)3/h4-6,11H,1-3H3,(H2,10,13,14) |
| InChIKey | TVLZUDZBPVZWBC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |