C14H20ClNO3 — CID 112573941
4-chloro-N-(3-ethoxycyclobutyl)-2,5-dimethoxyaniline (PubChem CID 112573941) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 4-chloro-N-(3-ethoxycyclobutyl)-2,5-dimethoxyaniline.
| Compound Name | 4-chloro-N-(3-ethoxycyclobutyl)-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 112573941 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 4-chloro-N-(3-ethoxycyclobutyl)-2,5-dimethoxyaniline |
| SMILES | CCOC1CC(Nc2cc(OC)c(Cl)cc2OC)C1 |
| InChI | InChI=1S/C14H20ClNO3/c1-4-19-10-5-9(6-10)16-12-8-13(17-2)11(15)7-14(12)18-3/h7-10,16H,4-6H2,1-3H3 |
| InChIKey | DNSVHSGAQUFQJX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |