C8H10ClF2NOS — CID 112575426
1-chloro-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1,1-difluoropropan-2-ol (PubChem CID 112575426) has the molecular formula C8H10ClF2NOS and a molecular weight of 241.69 g/mol. Its IUPAC name is 1-chloro-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1,1-difluoropropan-2-ol.
| Compound Name | 1-chloro-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112575426 |
| Molecular Formula | C8H10ClF2NOS |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 1-chloro-3-(4,5-dimethyl-1,3-thiazol-2-yl)-1,1-difluoropropan-2-ol |
| SMILES | Cc1nc(CC(O)C(F)(F)Cl)sc1C |
| InChI | InChI=1S/C8H10ClF2NOS/c1-4-5(2)14-7(12-4)3-6(13)8(9,10)11/h6,13H,3H2,1-2H3 |
| InChIKey | NCNJZLXWHLIWRB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|