C10H8F3NO5 — CID 112576193
3-nitro-2-(1,1,1-trifluoropropan-2-yloxy)benzoic acid (PubChem CID 112576193) has the molecular formula C10H8F3NO5 and a molecular weight of 279.17 g/mol. Its IUPAC name is 3-nitro-2-(1,1,1-trifluoropropan-2-yloxy)benzoic acid.
| Compound Name | 3-nitro-2-(1,1,1-trifluoropropan-2-yloxy)benzoic acid |
|---|---|
| PubChem CID | 112576193 |
| Molecular Formula | C10H8F3NO5 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-nitro-2-(1,1,1-trifluoropropan-2-yloxy)benzoic acid |
| SMILES | CC(Oc1c(C(=O)O)cccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO5/c1-5(10(11,12)13)19-8-6(9(15)16)3-2-4-7(8)14(17)18/h2-5H,1H3,(H,15,16) |
| InChIKey | ITVZEFOYHCTEHY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|