C10H9F3N2O4 — CID 112576857
2-[methyl(2,2,2-trifluoroethyl)amino]-3-nitrobenzoic acid (PubChem CID 112576857) has the molecular formula C10H9F3N2O4 and a molecular weight of 278.19 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)amino]-3-nitrobenzoic acid.
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 112576857 |
| Molecular Formula | C10H9F3N2O4 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-3-nitrobenzoic acid |
| SMILES | CN(CC(F)(F)F)c1c(C(=O)O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9F3N2O4/c1-14(5-10(11,12)13)8-6(9(16)17)3-2-4-7(8)15(18)19/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | IVMMBMTXNKZRDG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|