About 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline
5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline (PubChem CID 11257693) has the molecular formula C11H8BrCl2F2N3O
and a molecular weight of 387.01 g/mol. Its IUPAC name is 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline.
Molecular Properties
| Compound Name | 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline |
| PubChem CID | 11257693 |
| Molecular Formula | C11H8BrCl2F2N3O |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline |
| SMILES | Cn1nc(-c2cc(N)c(Cl)cc2Cl)c(Br)c1OC(F)F |
| InChI | InChI=1S/C11H8BrCl2F2N3O/c1-19-10(20-11(15)16)8(12)9(18-19)4-2-7(17)6(14)3-5(4)13/h2-3,11H,17H2,1H3 |
| InChIKey | LIGVLYBWGZAWSD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline?
The IUPAC name of 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline (CID 11257693) is 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline.
What is the SMILES notation for 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline?
The canonical SMILES for 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline is Cn1nc(-c2cc(N)c(Cl)cc2Cl)c(Br)c1OC(F)F.
What is the InChIKey of 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline?
The InChIKey is LIGVLYBWGZAWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrCl2F2N3O/c1-19-10(20-11(15)16)8(12)9(18-19)4-2-7(17)6(14)3-5(4)13/h2-3,11H,17H2,1H3.
What are the key properties of 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline?
5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline has a molecular weight of 387.01 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-bromo-5-(difluoromethoxy)-1-methylpyrazol-3-yl]-2,4-dichloroaniline is sourced from PubChem (CID 11257693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).