C23H39NO2Si — CID 11257776
(1S,3S,8S,9R,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one (PubChem CID 11257776) has the molecular formula C23H39NO2Si and a molecular weight of 389.66 g/mol. Its IUPAC name is (1S,3S,8S,9R,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one.
| Compound Name | (1S,3S,8S,9R,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one |
|---|---|
| PubChem CID | 11257776 |
| Molecular Formula | C23H39NO2Si |
| Molecular Weight | 389.66 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | (1S,3S,8S,9R,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-5,14-dimethyl-5-azatetracyclo[7.7.0.01,12.03,8]hexadec-14-en-16-one |
| SMILES | CC1=CC(=O)[C@]23C[C@@H]4CN(C)CC[C@@H]4[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]3C1 |
| InChI | InChI=1S/C23H39NO2Si/c1-15-10-17-12-19(26-27(6,7)22(2,3)4)21-18-8-9-24(5)14-16(18)13-23(17,21)20(25)11-15/h11,16-19,21H,8-10,12-14H2,1-7H3/t16-,17+,18+,19+,21+,23-/m1/s1 |
| InChIKey | OFZKGIJXXBSJQO-XWMZGJNUSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|