C23H26N4O2 — CID 11257801
2-[4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 11257801) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-[4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11257801 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-[4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | CC1(C)C=C(COc2ccc(-c3nc4c(C(N)=O)cccc4[nH]3)cc2)C(C)(C)N1 |
| InChI | InChI=1S/C23H26N4O2/c1-22(2)12-15(23(3,4)27-22)13-29-16-10-8-14(9-11-16)21-25-18-7-5-6-17(20(24)28)19(18)26-21/h5-12,27H,13H2,1-4H3,(H2,24,28)(H,25,26) |
| InChIKey | KINYDIYOQDQFLT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|