C21H21ClN6 — CID 11257875
N-(2-chloro-6-methylphenyl)-12-piperidin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine (PubChem CID 11257875) has the molecular formula C21H21ClN6 and a molecular weight of 392.89 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-12-piperidin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine.
| Compound Name | N-(2-chloro-6-methylphenyl)-12-piperidin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
|---|---|
| PubChem CID | 11257875 |
| Molecular Formula | C21H21ClN6 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-12-piperidin-1-yl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-amine |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CCCCC3)nc2n2cncc12 |
| InChI | InChI=1S/C21H21ClN6/c1-14-6-5-7-15(22)19(14)26-20-17-12-23-13-28(17)21-16(24-20)8-9-18(25-21)27-10-3-2-4-11-27/h5-9,12-13H,2-4,10-11H2,1H3,(H,24,26) |
| InChIKey | JDMKPTIBDMBQSP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |