About 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide
3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide (PubChem CID 112579182) has the molecular formula C12H14N4O3
and a molecular weight of 262.27 g/mol. Its IUPAC name is 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide.
Molecular Properties
| Compound Name | 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide |
| PubChem CID | 112579182 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide |
| SMILES | CN1C(=O)CC(Nc2c(N)cccc2C(N)=O)C1=O |
| InChI | InChI=1S/C12H14N4O3/c1-16-9(17)5-8(12(16)19)15-10-6(11(14)18)3-2-4-7(10)13/h2-4,8,15H,5,13H2,1H3,(H2,14,18) |
| InChIKey | BRLHYZXBOOYPBZ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide?
The IUPAC name of 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide (CID 112579182) is 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide.
What is the SMILES notation for 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide?
The canonical SMILES for 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide is CN1C(=O)CC(Nc2c(N)cccc2C(N)=O)C1=O.
What is the InChIKey of 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide?
The InChIKey is BRLHYZXBOOYPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3/c1-16-9(17)5-8(12(16)19)15-10-6(11(14)18)3-2-4-7(10)13/h2-4,8,15H,5,13H2,1H3,(H2,14,18).
What are the key properties of 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide?
3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide has a molecular weight of 262.27 g/mol, XLogP of -0.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzamide is sourced from PubChem (CID 112579182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).