C24H46O2Si — CID 11257931
(Z)-8-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methyloct-7-en-2-ol (PubChem CID 11257931) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (Z)-8-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methyloct-7-en-2-ol.
| Compound Name | (Z)-8-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methyloct-7-en-2-ol |
|---|---|
| PubChem CID | 11257931 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (Z)-8-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methyloct-7-en-2-ol |
| SMILES | CC(C)(O)CCCC/C=C\[C@]12CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC2 |
| InChI | InChI=1S/C24H46O2Si/c1-22(2,3)27(6,7)26-21-15-13-19-24(18-12-14-20(21)24)17-11-9-8-10-16-23(4,5)25/h11,17,20-21,25H,8-10,12-16,18-19H2,1-7H3/b17-11-/t20-,21+,24-/m0/s1 |
| InChIKey | HOLKIDVFUSSPKT-VAWCDJHCSA-N |
| XLogP | 7.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|