About 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid
4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid (PubChem CID 11257945) has the molecular formula C21H14FNO6
and a molecular weight of 395.34 g/mol. Its IUPAC name is 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid |
| PubChem CID | 11257945 |
| Molecular Formula | C21H14FNO6 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid |
| SMILES | CC(=O)N1c2cc(F)c(O)cc2Oc2cc(O)c(-c3ccc(C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C21H14FNO6/c1-10(24)23-15-6-13(11-2-4-12(5-3-11)21(27)28)17(25)8-19(15)29-20-9-18(26)14(22)7-16(20)23/h2-9,25-26H,1H3,(H,27,28) |
| InChIKey | BEVASIACGSQRAZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid?
The IUPAC name of 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid (CID 11257945) is 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid.
What is the SMILES notation for 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid?
The canonical SMILES for 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid is CC(=O)N1c2cc(F)c(O)cc2Oc2cc(O)c(-c3ccc(C(=O)O)cc3)cc21.
What is the InChIKey of 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid?
The InChIKey is BEVASIACGSQRAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FNO6/c1-10(24)23-15-6-13(11-2-4-12(5-3-11)21(27)28)17(25)8-19(15)29-20-9-18(26)14(22)7-16(20)23/h2-9,25-26H,1H3,(H,27,28).
What are the key properties of 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid?
4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid has a molecular weight of 395.34 g/mol, XLogP of 4.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(10-acetyl-8-fluoro-3,7-dihydroxyphenoxazin-2-yl)benzoic acid is sourced from PubChem (CID 11257945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).